C8H13O2S- — CID 163715987
3,4-dimethylcyclohex-3-ene-1-sulfinate (PubChem CID 163715987) has the molecular formula C8H13O2S- and a molecular weight of 173.26 g/mol. Its IUPAC name is 3,4-dimethylcyclohex-3-ene-1-sulfinate.
| Compound Name | 3,4-dimethylcyclohex-3-ene-1-sulfinate |
|---|---|
| PubChem CID | 163715987 |
| Molecular Formula | C8H13O2S- |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | 3,4-dimethylcyclohex-3-ene-1-sulfinate |
| SMILES | CC1=C(C)CC(S(=O)[O-])CC1 |
| InChI | InChI=1S/C8H14O2S/c1-6-3-4-8(11(9)10)5-7(6)2/h8H,3-5H2,1-2H3,(H,9,10)/p-1 |
| InChIKey | YTDRPTSZAXGMFJ-UHFFFAOYSA-M |
| XLogP | 1.75 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|