C6H8N6S — CID 55281996
[5-(1-methylpyrazol-4-yl)-1,3,4-thiadiazol-2-yl]hydrazine (PubChem CID 55281996) has the molecular formula C6H8N6S and a molecular weight of 196.24 g/mol. Its IUPAC name is [5-(1-methylpyrazol-4-yl)-1,3,4-thiadiazol-2-yl]hydrazine.
| Compound Name | [5-(1-methylpyrazol-4-yl)-1,3,4-thiadiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 55281996 |
| Molecular Formula | C6H8N6S |
| Molecular Weight | 196.24 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | [5-(1-methylpyrazol-4-yl)-1,3,4-thiadiazol-2-yl]hydrazine |
| SMILES | Cn1cc(-c2nnc(NN)s2)cn1 |
| InChI | InChI=1S/C6H8N6S/c1-12-3-4(2-8-12)5-10-11-6(9-7)13-5/h2-3H,7H2,1H3,(H,9,11) |
| InChIKey | UDZYFYSCWRUDGX-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.24 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|