C7H9N7 — CID 86704095
[6-(1-methylpyrazol-4-yl)-1,2,4-triazin-3-yl]hydrazine (PubChem CID 86704095) has the molecular formula C7H9N7 and a molecular weight of 191.20 g/mol. Its IUPAC name is [6-(1-methylpyrazol-4-yl)-1,2,4-triazin-3-yl]hydrazine.
| Compound Name | [6-(1-methylpyrazol-4-yl)-1,2,4-triazin-3-yl]hydrazine |
|---|---|
| PubChem CID | 86704095 |
| Molecular Formula | C7H9N7 |
| Molecular Weight | 191.20 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | [6-(1-methylpyrazol-4-yl)-1,2,4-triazin-3-yl]hydrazine |
| SMILES | Cn1cc(-c2cnc(NN)nn2)cn1 |
| InChI | InChI=1S/C7H9N7/c1-14-4-5(2-10-14)6-3-9-7(11-8)13-12-6/h2-4H,8H2,1H3,(H,9,11,13) |
| InChIKey | JXQLCJGXNXTZPH-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.20 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|