C10H9N3 — CID 58148330
CID 58148330 (PubChem CID 58148330) has the molecular formula C10H9N3 and a molecular weight of 171.20 g/mol.
| Compound Name | CID 58148330 |
|---|---|
| PubChem CID | 58148330 |
| Molecular Formula | C10H9N3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | — |
| SMILES | [CH]c1ccc(-c2cnn(C)c2)nc1 |
| InChI | InChI=1S/C10H9N3/c1-8-3-4-10(11-5-8)9-6-12-13(2)7-9/h1,3-7H,2H3 |
| InChIKey | HWEZWZJVVALQSF-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |