C10H15N3 — CID 55282374
3-[amino(cyclopropyl)methyl]benzene-1,2-diamine (PubChem CID 55282374) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is 3-[amino(cyclopropyl)methyl]benzene-1,2-diamine.
| Compound Name | 3-[amino(cyclopropyl)methyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 55282374 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 3-[amino(cyclopropyl)methyl]benzene-1,2-diamine |
| SMILES | Nc1cccc(C(N)C2CC2)c1N |
| InChI | InChI=1S/C10H15N3/c11-8-3-1-2-7(10(8)13)9(12)6-4-5-6/h1-3,6,9H,4-5,11-13H2 |
| InChIKey | QCFFZKRJVBDGOG-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|