C7H15N — CID 55284906
(3S)-3-methylcyclohexan-1-amine (PubChem CID 55284906) has the molecular formula C7H15N and a molecular weight of 113.20 g/mol. Its IUPAC name is (3S)-3-methylcyclohexan-1-amine.
| Compound Name | (3S)-3-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 55284906 |
| Molecular Formula | C7H15N |
| Molecular Weight | 113.20 g/mol |
| Exact Mass | 113.12 |
| IUPAC Name | (3S)-3-methylcyclohexan-1-amine |
| SMILES | C[C@H]1CCCC(N)C1 |
| InChI | InChI=1S/C7H15N/c1-6-3-2-4-7(8)5-6/h6-7H,2-5,8H2,1H3/t6-,7?/m0/s1 |
| InChIKey | JYDYHSHPBDZRPU-PKPIPKONSA-N |
| XLogP | 1.52 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.20 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |