About [5-(hydroxymethyl)-1,4-dihydropyrazin-2-yl]methanol
[5-(hydroxymethyl)-1,4-dihydropyrazin-2-yl]methanol (PubChem CID 55286313) has the molecular formula C6H10N2O2
and a molecular weight of 142.16 g/mol. Its IUPAC name is [5-(hydroxymethyl)-1,4-dihydropyrazin-2-yl]methanol.
Analyze [5-(hydroxymethyl)-1,4-dihydropyrazin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(hydroxymethyl)-1,4-dihydropyrazin-2-yl]methanol?
The IUPAC name of [5-(hydroxymethyl)-1,4-dihydropyrazin-2-yl]methanol (CID 55286313) is [5-(hydroxymethyl)-1,4-dihydropyrazin-2-yl]methanol.
What is the SMILES notation for [5-(hydroxymethyl)-1,4-dihydropyrazin-2-yl]methanol?
The canonical SMILES for [5-(hydroxymethyl)-1,4-dihydropyrazin-2-yl]methanol is OCC1=CNC(CO)=CN1.
What is the InChIKey of [5-(hydroxymethyl)-1,4-dihydropyrazin-2-yl]methanol?
The InChIKey is LCTFZVPTAVLAGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O2/c9-3-5-1-7-6(4-10)2-8-5/h1-2,7-10H,3-4H2.
What are the key properties of [5-(hydroxymethyl)-1,4-dihydropyrazin-2-yl]methanol?
[5-(hydroxymethyl)-1,4-dihydropyrazin-2-yl]methanol has a molecular weight of 142.16 g/mol, XLogP of -1.15, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(hydroxymethyl)-1,4-dihydropyrazin-2-yl]methanol is sourced from PubChem (CID 55286313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).