C6H12N2O2 — CID 55287477
4-methoxy-5-methyl-1,3-diazinan-2-one (PubChem CID 55287477) has the molecular formula C6H12N2O2 and a molecular weight of 144.17 g/mol. Its IUPAC name is 4-methoxy-5-methyl-1,3-diazinan-2-one.
| Compound Name | 4-methoxy-5-methyl-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 55287477 |
| Molecular Formula | C6H12N2O2 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | 4-methoxy-5-methyl-1,3-diazinan-2-one |
| SMILES | COC1NC(=O)NCC1C |
| InChI | InChI=1S/C6H12N2O2/c1-4-3-7-6(9)8-5(4)10-2/h4-5H,3H2,1-2H3,(H2,7,8,9) |
| InChIKey | PTRVUNSYLATVJX-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |