C4H8N2O2 — CID 58880532
2-methyl-1,3,5-oxadiazinan-4-one (PubChem CID 58880532) has the molecular formula C4H8N2O2 and a molecular weight of 116.12 g/mol. Its IUPAC name is 2-methyl-1,3,5-oxadiazinan-4-one.
| Compound Name | 2-methyl-1,3,5-oxadiazinan-4-one |
|---|---|
| PubChem CID | 58880532 |
| Molecular Formula | C4H8N2O2 |
| Molecular Weight | 116.12 g/mol |
| Exact Mass | 116.06 |
| IUPAC Name | 2-methyl-1,3,5-oxadiazinan-4-one |
| SMILES | CC1NC(=O)NCO1 |
| InChI | InChI=1S/C4H8N2O2/c1-3-6-4(7)5-2-8-3/h3H,2H2,1H3,(H2,5,6,7) |
| InChIKey | MAJWUBFGXHZSGX-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.12 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |