About 2-aminoethyl methyl carbonate
2-aminoethyl methyl carbonate (PubChem CID 55288697) has the molecular formula C4H9NO3
and a molecular weight of 119.12 g/mol. Its IUPAC name is 2-aminoethyl methyl carbonate.
Molecular Properties
| Compound Name | 2-aminoethyl methyl carbonate |
| PubChem CID | 55288697 |
| Molecular Formula | C4H9NO3 |
| Molecular Weight | 119.12 g/mol |
| Exact Mass | 119.06 |
| IUPAC Name | 2-aminoethyl methyl carbonate |
| SMILES | COC(=O)OCCN |
| InChI | InChI=1S/C4H9NO3/c1-7-4(6)8-3-2-5/h2-3,5H2,1H3 |
| InChIKey | NPBARHFCUXXUMX-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.12 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-aminoethyl methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethyl methyl carbonate?
The IUPAC name of 2-aminoethyl methyl carbonate (CID 55288697) is 2-aminoethyl methyl carbonate.
What is the SMILES notation for 2-aminoethyl methyl carbonate?
The canonical SMILES for 2-aminoethyl methyl carbonate is COC(=O)OCCN.
What is the InChIKey of 2-aminoethyl methyl carbonate?
The InChIKey is NPBARHFCUXXUMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO3/c1-7-4(6)8-3-2-5/h2-3,5H2,1H3.
What are the key properties of 2-aminoethyl methyl carbonate?
2-aminoethyl methyl carbonate has a molecular weight of 119.12 g/mol, XLogP of -0.27, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethyl methyl carbonate is sourced from PubChem (CID 55288697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).