C7H13NO2 — CID 55289009
(3S,4R)-3-methyloxane-4-carboxamide (PubChem CID 55289009) has the molecular formula C7H13NO2 and a molecular weight of 143.19 g/mol. Its IUPAC name is (3S,4R)-3-methyloxane-4-carboxamide.
| Compound Name | (3S,4R)-3-methyloxane-4-carboxamide |
|---|---|
| PubChem CID | 55289009 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | (3S,4R)-3-methyloxane-4-carboxamide |
| SMILES | C[C@@H]1COCC[C@H]1C(N)=O |
| InChI | InChI=1S/C7H13NO2/c1-5-4-10-3-2-6(5)7(8)9/h5-6H,2-4H2,1H3,(H2,8,9)/t5-,6-/m1/s1 |
| InChIKey | SIPGKNYZNUKQDB-PHDIDXHHSA-N |
| XLogP | 0.14 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |