C9H13NOS — CID 55292192
[3-[(S)-amino(cyclopropyl)methyl]thiophen-2-yl]methanol (PubChem CID 55292192) has the molecular formula C9H13NOS and a molecular weight of 183.28 g/mol. Its IUPAC name is [3-[(S)-amino(cyclopropyl)methyl]thiophen-2-yl]methanol.
| Compound Name | [3-[(S)-amino(cyclopropyl)methyl]thiophen-2-yl]methanol |
|---|---|
| PubChem CID | 55292192 |
| Molecular Formula | C9H13NOS |
| Molecular Weight | 183.28 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | [3-[(S)-amino(cyclopropyl)methyl]thiophen-2-yl]methanol |
| SMILES | N[C@H](c1ccsc1CO)C1CC1 |
| InChI | InChI=1S/C9H13NOS/c10-9(6-1-2-6)7-3-4-12-8(7)5-11/h3-4,6,9,11H,1-2,5,10H2/t9-/m0/s1 |
| InChIKey | JZRCMGSYFPIKNB-VIFPVBQESA-N |
| XLogP | 1.65 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.28 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |