C8H10N2OS — CID 55292478
(3S)-3-amino-3-[2-(hydroxymethyl)thiophen-3-yl]propanenitrile (PubChem CID 55292478) has the molecular formula C8H10N2OS and a molecular weight of 182.25 g/mol. Its IUPAC name is (3S)-3-amino-3-[2-(hydroxymethyl)thiophen-3-yl]propanenitrile.
| Compound Name | (3S)-3-amino-3-[2-(hydroxymethyl)thiophen-3-yl]propanenitrile |
|---|---|
| PubChem CID | 55292478 |
| Molecular Formula | C8H10N2OS |
| Molecular Weight | 182.25 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | (3S)-3-amino-3-[2-(hydroxymethyl)thiophen-3-yl]propanenitrile |
| SMILES | N#CC[C@H](N)c1ccsc1CO |
| InChI | InChI=1S/C8H10N2OS/c9-3-1-7(10)6-2-4-12-8(6)5-11/h2,4,7,11H,1,5,10H2/t7-/m0/s1 |
| InChIKey | NVUSQOXEBYKXFV-ZETCQYMHSA-N |
| XLogP | 1.15 |
| TPSA | 70.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.25 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |