2-amino-2-(3-methoxy-2-pyridinyl)acetic acid

C8H10N2O3 — CID 55295273

IUPAC2-amino-2-(3-methoxy-2-pyridinyl)acetic acid
SMILESCOc1cccnc1C(N)C(=O)O
InChIInChI=1S/C8H10N2O3/c1-13-5-3-2-4-10-7(5)6(9)8(11)12/h2-4,6H,9H2,1H3,(H,11,12)
InChIKeyCZKAWDNLKYPTDN-UHFFFAOYSA-N
MW182.18 g/mol
LogP0.17
Rot. Bonds3

About 2-amino-2-(3-methoxy-2-pyridinyl)acetic acid

2-amino-2-(3-methoxy-2-pyridinyl)acetic acid (PubChem CID 55295273) has the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. Its IUPAC name is 2-amino-2-(3-methoxy-2-pyridinyl)acetic acid.

Molecular Properties

Compound Name2-amino-2-(3-methoxy-2-pyridinyl)acetic acid
PubChem CID55295273
Molecular FormulaC8H10N2O3
Molecular Weight182.18 g/mol
Exact Mass182.07
IUPAC Name2-amino-2-(3-methoxy-2-pyridinyl)acetic acid
SMILESCOc1cccnc1C(N)C(=O)O
InChIInChI=1S/C8H10N2O3/c1-13-5-3-2-4-10-7(5)6(9)8(11)12/h2-4,6H,9H2,1H3,(H,11,12)
InChIKeyCZKAWDNLKYPTDN-UHFFFAOYSA-N
XLogP0.17
TPSA85.44 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500182.18
LogP ≤ 50.17
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-amino-2-(3-methoxy-2-pyridinyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-(3-methoxy-2-pyridinyl)-4-methylpentanoic acid
CID 86811528
(2S)-2-(3-methoxy-2-pyridinyl)-4-methylpentanoic acid
CID 98041226
(2R)-2-amino-2-(3-methoxy-2-pyridinyl)ethanol
CID 96850177
(1S)-1-(3-methoxy-2-pyridinyl)-2-methylpropan-1-amine
CID 130691803
2-(dichloromethyl)-3-methoxypyridine
CID 141354456
3-(4-bromophenyl)-2-(3-methoxy-2-pyridinyl)propanoic acid
CID 104572566
2-(3-methoxy-2-pyridinyl)-3-(2-methylphenyl)propanoic acid
CID 104572925
2,2-difluoro-1-(3-methoxy-2-pyridinyl)propan-1-amine
CID 130650453
1-(3-methoxy-2-pyridinyl)-2-phenylethane-1,2-diol
CID 114053795
(2R)-2-amino-2-(6-formyl-3-methoxy-2-pyridinyl)acetic acid
CID 123382658
3-(2-bromophenyl)-2-(3-methoxy-2-pyridinyl)propanoic acid
CID 104572490
2-(3-methoxy-2-pyridinyl)acetic acid
CID 53411457

Frequently Asked Questions

What is the IUPAC name of 2-amino-2-(3-methoxy-2-pyridinyl)acetic acid?
The IUPAC name of 2-amino-2-(3-methoxy-2-pyridinyl)acetic acid (CID 55295273) is 2-amino-2-(3-methoxy-2-pyridinyl)acetic acid.
What is the SMILES notation for 2-amino-2-(3-methoxy-2-pyridinyl)acetic acid?
The canonical SMILES for 2-amino-2-(3-methoxy-2-pyridinyl)acetic acid is COc1cccnc1C(N)C(=O)O.
What is the InChIKey of 2-amino-2-(3-methoxy-2-pyridinyl)acetic acid?
The InChIKey is CZKAWDNLKYPTDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O3/c1-13-5-3-2-4-10-7(5)6(9)8(11)12/h2-4,6H,9H2,1H3,(H,11,12).
What are the key properties of 2-amino-2-(3-methoxy-2-pyridinyl)acetic acid?
2-amino-2-(3-methoxy-2-pyridinyl)acetic acid has a molecular weight of 182.18 g/mol, XLogP of 0.17, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-(3-methoxy-2-pyridinyl)acetic acid is sourced from PubChem (CID 55295273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).