C14H15NO3 — CID 114053795
1-(3-methoxy-2-pyridinyl)-2-phenylethane-1,2-diol (PubChem CID 114053795) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is 1-(3-methoxy-2-pyridinyl)-2-phenylethane-1,2-diol.
| Compound Name | 1-(3-methoxy-2-pyridinyl)-2-phenylethane-1,2-diol |
|---|---|
| PubChem CID | 114053795 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 1-(3-methoxy-2-pyridinyl)-2-phenylethane-1,2-diol |
| SMILES | COc1cccnc1C(O)C(O)c1ccccc1 |
| InChI | InChI=1S/C14H15NO3/c1-18-11-8-5-9-15-12(11)14(17)13(16)10-6-3-2-4-7-10/h2-9,13-14,16-17H,1H3 |
| InChIKey | NYCMPLAZBLISFD-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |