C17H34O8Si2 — CID 552957
[4-acetyloxy-6-methoxy-3,5-bis(trimethylsilyloxy)oxan-2-yl]methyl acetate (PubChem CID 552957) has the molecular formula C17H34O8Si2 and a molecular weight of 422.62 g/mol. Its IUPAC name is [4-acetyloxy-6-methoxy-3,5-bis(trimethylsilyloxy)oxan-2-yl]methyl acetate.
| Compound Name | [4-acetyloxy-6-methoxy-3,5-bis(trimethylsilyloxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 552957 |
| Molecular Formula | C17H34O8Si2 |
| Molecular Weight | 422.62 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | [4-acetyloxy-6-methoxy-3,5-bis(trimethylsilyloxy)oxan-2-yl]methyl acetate |
| SMILES | COC1OC(COC(C)=O)C(O[Si](C)(C)C)C(OC(C)=O)C1O[Si](C)(C)C |
| InChI | InChI=1S/C17H34O8Si2/c1-11(18)21-10-13-14(24-26(4,5)6)15(22-12(2)19)16(17(20-3)23-13)25-27(7,8)9/h13-17H,10H2,1-9H3 |
| InChIKey | ITGKZNAFHOGTIJ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.62 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|