C5H8ClNO — CID 55298503
2-(chloromethyl)-4-methyl-4,5-dihydro-1,3-oxazole (PubChem CID 55298503) has the molecular formula C5H8ClNO and a molecular weight of 133.58 g/mol. Its IUPAC name is 2-(chloromethyl)-4-methyl-4,5-dihydro-1,3-oxazole.
| Compound Name | 2-(chloromethyl)-4-methyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 55298503 |
| Molecular Formula | C5H8ClNO |
| Molecular Weight | 133.58 g/mol |
| Exact Mass | 133.03 |
| IUPAC Name | 2-(chloromethyl)-4-methyl-4,5-dihydro-1,3-oxazole |
| SMILES | CC1COC(CCl)=N1 |
| InChI | InChI=1S/C5H8ClNO/c1-4-3-8-5(2-6)7-4/h4H,2-3H2,1H3 |
| InChIKey | TYYCXOVEVABBOO-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.58 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|