C5H6N2O2 — CID 55300853
3-(methylamino)pyrrole-2,5-dione (PubChem CID 55300853) has the molecular formula C5H6N2O2 and a molecular weight of 126.11 g/mol. Its IUPAC name is 3-(methylamino)pyrrole-2,5-dione.
| Compound Name | 3-(methylamino)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 55300853 |
| Molecular Formula | C5H6N2O2 |
| Molecular Weight | 126.11 g/mol |
| Exact Mass | 126.04 |
| IUPAC Name | 3-(methylamino)pyrrole-2,5-dione |
| SMILES | CNC1=CC(=O)NC1=O |
| InChI | InChI=1S/C5H6N2O2/c1-6-3-2-4(8)7-5(3)9/h2H,1H3,(H2,6,7,8,9) |
| InChIKey | QBIHKTYASZEKGS-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.11 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|