C19H24BrNO4 — CID 55306420
[2-[(2-methylcyclohexyl)amino]-2-oxoethyl] 4-(4-bromophenyl)-4-oxobutanoate (PubChem CID 55306420) has the molecular formula C19H24BrNO4 and a molecular weight of 410.31 g/mol. Its IUPAC name is [2-[(2-methylcyclohexyl)amino]-2-oxoethyl] 4-(4-bromophenyl)-4-oxobutanoate.
| Compound Name | [2-[(2-methylcyclohexyl)amino]-2-oxoethyl] 4-(4-bromophenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 55306420 |
| Molecular Formula | C19H24BrNO4 |
| Molecular Weight | 410.31 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | [2-[(2-methylcyclohexyl)amino]-2-oxoethyl] 4-(4-bromophenyl)-4-oxobutanoate |
| SMILES | CC1CCCCC1NC(=O)COC(=O)CCC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H24BrNO4/c1-13-4-2-3-5-16(13)21-18(23)12-25-19(24)11-10-17(22)14-6-8-15(20)9-7-14/h6-9,13,16H,2-5,10-12H2,1H3,(H,21,23) |
| InChIKey | WOUGMMDIQAHGGC-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.31 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |