C23H33NO5S — CID 55310534
[2-(dicyclohexylamino)-2-oxoethyl] 4-(methylsulfonylmethyl)benzoate (PubChem CID 55310534) has the molecular formula C23H33NO5S and a molecular weight of 435.59 g/mol. Its IUPAC name is [2-(dicyclohexylamino)-2-oxoethyl] 4-(methylsulfonylmethyl)benzoate.
| Compound Name | [2-(dicyclohexylamino)-2-oxoethyl] 4-(methylsulfonylmethyl)benzoate |
|---|---|
| PubChem CID | 55310534 |
| Molecular Formula | C23H33NO5S |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | [2-(dicyclohexylamino)-2-oxoethyl] 4-(methylsulfonylmethyl)benzoate |
| SMILES | CS(=O)(=O)Cc1ccc(C(=O)OCC(=O)N(C2CCCCC2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C23H33NO5S/c1-30(27,28)17-18-12-14-19(15-13-18)23(26)29-16-22(25)24(20-8-4-2-5-9-20)21-10-6-3-7-11-21/h12-15,20-21H,2-11,16-17H2,1H3 |
| InChIKey | MKMAFXZRKUIPRH-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |