About [2-[4-[2-(4-methylpentanoyloxy)acetyl]piperazin-1-yl]-2-oxoethyl] 4-methylpentanoate
[2-[4-[2-(4-methylpentanoyloxy)acetyl]piperazin-1-yl]-2-oxoethyl] 4-methylpentanoate (PubChem CID 55311881) has the molecular formula C20H34N2O6
and a molecular weight of 398.50 g/mol. Its IUPAC name is [2-[4-[2-(4-methylpentanoyloxy)acetyl]piperazin-1-yl]-2-oxoethyl] 4-methylpentanoate.
Molecular Properties
| Compound Name | [2-[4-[2-(4-methylpentanoyloxy)acetyl]piperazin-1-yl]-2-oxoethyl] 4-methylpentanoate |
| PubChem CID | 55311881 |
| Molecular Formula | C20H34N2O6 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | [2-[4-[2-(4-methylpentanoyloxy)acetyl]piperazin-1-yl]-2-oxoethyl] 4-methylpentanoate |
| SMILES | CC(C)CCC(=O)OCC(=O)N1CCN(C(=O)COC(=O)CCC(C)C)CC1 |
| InChI | InChI=1S/C20H34N2O6/c1-15(2)5-7-19(25)27-13-17(23)21-9-11-22(12-10-21)18(24)14-28-20(26)8-6-16(3)4/h15-16H,5-14H2,1-4H3 |
| InChIKey | PLBKRHGZUZGYRR-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-[4-[2-(4-methylpentanoyloxy)acetyl]piperazin-1-yl]-2-oxoethyl] 4-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[4-[2-(4-methylpentanoyloxy)acetyl]piperazin-1-yl]-2-oxoethyl] 4-methylpentanoate?
The IUPAC name of [2-[4-[2-(4-methylpentanoyloxy)acetyl]piperazin-1-yl]-2-oxoethyl] 4-methylpentanoate (CID 55311881) is [2-[4-[2-(4-methylpentanoyloxy)acetyl]piperazin-1-yl]-2-oxoethyl] 4-methylpentanoate.
What is the SMILES notation for [2-[4-[2-(4-methylpentanoyloxy)acetyl]piperazin-1-yl]-2-oxoethyl] 4-methylpentanoate?
The canonical SMILES for [2-[4-[2-(4-methylpentanoyloxy)acetyl]piperazin-1-yl]-2-oxoethyl] 4-methylpentanoate is CC(C)CCC(=O)OCC(=O)N1CCN(C(=O)COC(=O)CCC(C)C)CC1.
What is the InChIKey of [2-[4-[2-(4-methylpentanoyloxy)acetyl]piperazin-1-yl]-2-oxoethyl] 4-methylpentanoate?
The InChIKey is PLBKRHGZUZGYRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H34N2O6/c1-15(2)5-7-19(25)27-13-17(23)21-9-11-22(12-10-21)18(24)14-28-20(26)8-6-16(3)4/h15-16H,5-14H2,1-4H3.
What are the key properties of [2-[4-[2-(4-methylpentanoyloxy)acetyl]piperazin-1-yl]-2-oxoethyl] 4-methylpentanoate?
[2-[4-[2-(4-methylpentanoyloxy)acetyl]piperazin-1-yl]-2-oxoethyl] 4-methylpentanoate has a molecular weight of 398.50 g/mol, XLogP of 1.62, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[4-[2-(4-methylpentanoyloxy)acetyl]piperazin-1-yl]-2-oxoethyl] 4-methylpentanoate is sourced from PubChem (CID 55311881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).