About (2-oxo-2-pyrrolidin-1-ylethyl) 4-ethoxybutanoate
(2-oxo-2-pyrrolidin-1-ylethyl) 4-ethoxybutanoate (PubChem CID 78876077) has the molecular formula C12H21NO4
and a molecular weight of 243.30 g/mol. Its IUPAC name is (2-oxo-2-pyrrolidin-1-ylethyl) 4-ethoxybutanoate.
Molecular Properties
| Compound Name | (2-oxo-2-pyrrolidin-1-ylethyl) 4-ethoxybutanoate |
| PubChem CID | 78876077 |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | (2-oxo-2-pyrrolidin-1-ylethyl) 4-ethoxybutanoate |
| SMILES | CCOCCCC(=O)OCC(=O)N1CCCC1 |
| InChI | InChI=1S/C12H21NO4/c1-2-16-9-5-6-12(15)17-10-11(14)13-7-3-4-8-13/h2-10H2,1H3 |
| InChIKey | HVYZOOVGDUXYDJ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2-oxo-2-pyrrolidin-1-ylethyl) 4-ethoxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxo-2-pyrrolidin-1-ylethyl) 4-ethoxybutanoate?
The IUPAC name of (2-oxo-2-pyrrolidin-1-ylethyl) 4-ethoxybutanoate (CID 78876077) is (2-oxo-2-pyrrolidin-1-ylethyl) 4-ethoxybutanoate.
What is the SMILES notation for (2-oxo-2-pyrrolidin-1-ylethyl) 4-ethoxybutanoate?
The canonical SMILES for (2-oxo-2-pyrrolidin-1-ylethyl) 4-ethoxybutanoate is CCOCCCC(=O)OCC(=O)N1CCCC1.
What is the InChIKey of (2-oxo-2-pyrrolidin-1-ylethyl) 4-ethoxybutanoate?
The InChIKey is HVYZOOVGDUXYDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO4/c1-2-16-9-5-6-12(15)17-10-11(14)13-7-3-4-8-13/h2-10H2,1H3.
What are the key properties of (2-oxo-2-pyrrolidin-1-ylethyl) 4-ethoxybutanoate?
(2-oxo-2-pyrrolidin-1-ylethyl) 4-ethoxybutanoate has a molecular weight of 243.30 g/mol, XLogP of 0.97, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxo-2-pyrrolidin-1-ylethyl) 4-ethoxybutanoate is sourced from PubChem (CID 78876077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).