About diethyl pentanedioate;2-ethoxyethanol
diethyl pentanedioate;2-ethoxyethanol (PubChem CID 174867931) has the molecular formula C13H26O6
and a molecular weight of 278.34 g/mol. Its IUPAC name is diethyl pentanedioate;2-ethoxyethanol.
Molecular Properties
| Compound Name | diethyl pentanedioate;2-ethoxyethanol |
| PubChem CID | 174867931 |
| Molecular Formula | C13H26O6 |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | diethyl pentanedioate;2-ethoxyethanol |
| SMILES | CCOC(=O)CCCC(=O)OCC.CCOCCO |
| InChI | InChI=1S/C9H16O4.C4H10O2/c1-3-12-8(10)6-5-7-9(11)13-4-2;1-2-6-4-3-5/h3-7H2,1-2H3;5H,2-4H2,1H3 |
| InChIKey | CPULSOOVGVGXQR-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze diethyl pentanedioate;2-ethoxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl pentanedioate;2-ethoxyethanol?
The IUPAC name of diethyl pentanedioate;2-ethoxyethanol (CID 174867931) is diethyl pentanedioate;2-ethoxyethanol.
What is the SMILES notation for diethyl pentanedioate;2-ethoxyethanol?
The canonical SMILES for diethyl pentanedioate;2-ethoxyethanol is CCOC(=O)CCCC(=O)OCC.CCOCCO.
What is the InChIKey of diethyl pentanedioate;2-ethoxyethanol?
The InChIKey is CPULSOOVGVGXQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O4.C4H10O2/c1-3-12-8(10)6-5-7-9(11)13-4-2;1-2-6-4-3-5/h3-7H2,1-2H3;5H,2-4H2,1H3.
What are the key properties of diethyl pentanedioate;2-ethoxyethanol?
diethyl pentanedioate;2-ethoxyethanol has a molecular weight of 278.34 g/mol, XLogP of 1.30, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl pentanedioate;2-ethoxyethanol is sourced from PubChem (CID 174867931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).