About cyclohexane;ethyl 4-hydroxybutanoate
cyclohexane;ethyl 4-hydroxybutanoate (PubChem CID 67158425) has the molecular formula C12H24O3
and a molecular weight of 216.32 g/mol. Its IUPAC name is cyclohexane;ethyl 4-hydroxybutanoate.
Molecular Properties
| Compound Name | cyclohexane;ethyl 4-hydroxybutanoate |
| PubChem CID | 67158425 |
| Molecular Formula | C12H24O3 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | cyclohexane;ethyl 4-hydroxybutanoate |
| SMILES | C1CCCCC1.CCOC(=O)CCCO |
| InChI | InChI=1S/C6H12O3.C6H12/c1-2-9-6(8)4-3-5-7;1-2-4-6-5-3-1/h7H,2-5H2,1H3;1-6H2 |
| InChIKey | CUYCBNMSQZFBJE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclohexane;ethyl 4-hydroxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexane;ethyl 4-hydroxybutanoate?
The IUPAC name of cyclohexane;ethyl 4-hydroxybutanoate (CID 67158425) is cyclohexane;ethyl 4-hydroxybutanoate.
What is the SMILES notation for cyclohexane;ethyl 4-hydroxybutanoate?
The canonical SMILES for cyclohexane;ethyl 4-hydroxybutanoate is C1CCCCC1.CCOC(=O)CCCO.
What is the InChIKey of cyclohexane;ethyl 4-hydroxybutanoate?
The InChIKey is CUYCBNMSQZFBJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O3.C6H12/c1-2-9-6(8)4-3-5-7;1-2-4-6-5-3-1/h7H,2-5H2,1H3;1-6H2.
What are the key properties of cyclohexane;ethyl 4-hydroxybutanoate?
cyclohexane;ethyl 4-hydroxybutanoate has a molecular weight of 216.32 g/mol, XLogP of 2.66, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexane;ethyl 4-hydroxybutanoate is sourced from PubChem (CID 67158425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).