C20H19NO6 — CID 55312482
(3-nitrophenyl)methyl 3-(propan-2-yloxymethyl)-1-benzofuran-2-carboxylate (PubChem CID 55312482) has the molecular formula C20H19NO6 and a molecular weight of 369.37 g/mol. Its IUPAC name is (3-nitrophenyl)methyl 3-(propan-2-yloxymethyl)-1-benzofuran-2-carboxylate.
| Compound Name | (3-nitrophenyl)methyl 3-(propan-2-yloxymethyl)-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 55312482 |
| Molecular Formula | C20H19NO6 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | (3-nitrophenyl)methyl 3-(propan-2-yloxymethyl)-1-benzofuran-2-carboxylate |
| SMILES | CC(C)OCc1c(C(=O)OCc2cccc([N+](=O)[O-])c2)oc2ccccc12 |
| InChI | InChI=1S/C20H19NO6/c1-13(2)25-12-17-16-8-3-4-9-18(16)27-19(17)20(22)26-11-14-6-5-7-15(10-14)21(23)24/h3-10,13H,11-12H2,1-2H3 |
| InChIKey | JBBIVNUZFKDUMR-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 91.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|