C17H36O4Si2 — CID 553139
bis[tert-butyl(dimethyl)silyl] 2,2-dimethylpropanedioate (PubChem CID 553139) has the molecular formula C17H36O4Si2 and a molecular weight of 360.64 g/mol. Its IUPAC name is bis[tert-butyl(dimethyl)silyl] 2,2-dimethylpropanedioate.
| Compound Name | bis[tert-butyl(dimethyl)silyl] 2,2-dimethylpropanedioate |
|---|---|
| PubChem CID | 553139 |
| Molecular Formula | C17H36O4Si2 |
| Molecular Weight | 360.64 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | bis[tert-butyl(dimethyl)silyl] 2,2-dimethylpropanedioate |
| SMILES | CC(C)(C(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H36O4Si2/c1-15(2,3)22(9,10)20-13(18)17(7,8)14(19)21-23(11,12)16(4,5)6/h1-12H3 |
| InChIKey | ZBYZHGVYKOKRAB-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.64 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|