C20H24N2O3S — CID 55315696
[1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 3-phenylsulfanylpropanoate (PubChem CID 55315696) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 3-phenylsulfanylpropanoate.
| Compound Name | [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 3-phenylsulfanylpropanoate |
|---|---|
| PubChem CID | 55315696 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 3-phenylsulfanylpropanoate |
| SMILES | CC(OC(=O)CCSc1ccccc1)C(=O)Nc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C20H24N2O3S/c1-15(20(24)21-16-9-11-17(12-10-16)22(2)3)25-19(23)13-14-26-18-7-5-4-6-8-18/h4-12,15H,13-14H2,1-3H3,(H,21,24) |
| InChIKey | QVFKUVLIQYOFAC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|