C24H25FN2O5S — CID 55316037
[1-(naphthalen-2-ylamino)-1-oxopropan-2-yl] 3-(diethylsulfamoyl)-4-fluorobenzoate (PubChem CID 55316037) has the molecular formula C24H25FN2O5S and a molecular weight of 472.54 g/mol. Its IUPAC name is [1-(naphthalen-2-ylamino)-1-oxopropan-2-yl] 3-(diethylsulfamoyl)-4-fluorobenzoate.
| Compound Name | [1-(naphthalen-2-ylamino)-1-oxopropan-2-yl] 3-(diethylsulfamoyl)-4-fluorobenzoate |
|---|---|
| PubChem CID | 55316037 |
| Molecular Formula | C24H25FN2O5S |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | [1-(naphthalen-2-ylamino)-1-oxopropan-2-yl] 3-(diethylsulfamoyl)-4-fluorobenzoate |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)OC(C)C(=O)Nc2ccc3ccccc3c2)ccc1F |
| InChI | InChI=1S/C24H25FN2O5S/c1-4-27(5-2)33(30,31)22-15-19(11-13-21(22)25)24(29)32-16(3)23(28)26-20-12-10-17-8-6-7-9-18(17)14-20/h6-16H,4-5H2,1-3H3,(H,26,28) |
| InChIKey | OSGRHWBFYJNUMF-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |