C25H25FN4O3S — CID 55319648
[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methyl (E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoate (PubChem CID 55319648) has the molecular formula C25H25FN4O3S and a molecular weight of 480.57 g/mol. Its IUPAC name is [2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methyl (E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoate.
| Compound Name | [2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methyl (E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoate |
|---|---|
| PubChem CID | 55319648 |
| Molecular Formula | C25H25FN4O3S |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | [2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methyl (E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoate |
| SMILES | CCCn1c(C)cc(/C=C(\C#N)C(=O)OCc2csc(N(C(C)=O)c3ccccc3F)n2)c1C |
| InChI | InChI=1S/C25H25FN4O3S/c1-5-10-29-16(2)11-19(17(29)3)12-20(13-27)24(32)33-14-21-15-34-25(28-21)30(18(4)31)23-9-7-6-8-22(23)26/h6-9,11-12,15H,5,10,14H2,1-4H3/b20-12+ |
| InChIKey | ODSQXRGIQILZDN-UDWIEESQSA-N |
| XLogP | 5.45 |
| TPSA | 88.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|