C21H32N2O5S — CID 55320301
[1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl] 5-(diethylsulfamoyl)-2-methylbenzoate (PubChem CID 55320301) has the molecular formula C21H32N2O5S and a molecular weight of 424.56 g/mol. Its IUPAC name is [1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl] 5-(diethylsulfamoyl)-2-methylbenzoate.
| Compound Name | [1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl] 5-(diethylsulfamoyl)-2-methylbenzoate |
|---|---|
| PubChem CID | 55320301 |
| Molecular Formula | C21H32N2O5S |
| Molecular Weight | 424.56 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | [1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl] 5-(diethylsulfamoyl)-2-methylbenzoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C)c(C(=O)OC(C)C(=O)N2CCC(C)CC2)c1 |
| InChI | InChI=1S/C21H32N2O5S/c1-6-23(7-2)29(26,27)18-9-8-16(4)19(14-18)21(25)28-17(5)20(24)22-12-10-15(3)11-13-22/h8-9,14-15,17H,6-7,10-13H2,1-5H3 |
| InChIKey | MCMROAVNQONQFF-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.56 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |