C22H22FN3O5S — CID 55321837
[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methyl 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetate (PubChem CID 55321837) has the molecular formula C22H22FN3O5S and a molecular weight of 459.50 g/mol. Its IUPAC name is [2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methyl 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetate.
| Compound Name | [2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methyl 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 55321837 |
| Molecular Formula | C22H22FN3O5S |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | [2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methyl 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetate |
| SMILES | CC(=O)N(c1nc(COC(=O)CN2C(=O)C3CCCCC3C2=O)cs1)c1ccccc1F |
| InChI | InChI=1S/C22H22FN3O5S/c1-13(27)26(18-9-5-4-8-17(18)23)22-24-14(12-32-22)11-31-19(28)10-25-20(29)15-6-2-3-7-16(15)21(25)30/h4-5,8-9,12,15-16H,2-3,6-7,10-11H2,1H3 |
| InChIKey | PSHQHNZPNGOOFJ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 96.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|