C23H24N2O5 — CID 55323049
[2-[benzyl(2-phenylethyl)amino]-2-oxoethyl] 2-(2,5-dioxopyrrolidin-1-yl)acetate (PubChem CID 55323049) has the molecular formula C23H24N2O5 and a molecular weight of 408.45 g/mol. Its IUPAC name is [2-[benzyl(2-phenylethyl)amino]-2-oxoethyl] 2-(2,5-dioxopyrrolidin-1-yl)acetate.
| Compound Name | [2-[benzyl(2-phenylethyl)amino]-2-oxoethyl] 2-(2,5-dioxopyrrolidin-1-yl)acetate |
|---|---|
| PubChem CID | 55323049 |
| Molecular Formula | C23H24N2O5 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | [2-[benzyl(2-phenylethyl)amino]-2-oxoethyl] 2-(2,5-dioxopyrrolidin-1-yl)acetate |
| SMILES | O=C(CN1C(=O)CCC1=O)OCC(=O)N(CCc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C23H24N2O5/c26-20-11-12-21(27)25(20)16-23(29)30-17-22(28)24(15-19-9-5-2-6-10-19)14-13-18-7-3-1-4-8-18/h1-10H,11-17H2 |
| InChIKey | SVVNZYXRCYRDBV-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|