C19H19Cl2NO3 — CID 55326168
2-(3-acetylphenoxy)-N-[1-(2,4-dichlorophenyl)ethyl]propanamide (PubChem CID 55326168) has the molecular formula C19H19Cl2NO3 and a molecular weight of 380.27 g/mol. Its IUPAC name is 2-(3-acetylphenoxy)-N-[1-(2,4-dichlorophenyl)ethyl]propanamide.
| Compound Name | 2-(3-acetylphenoxy)-N-[1-(2,4-dichlorophenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 55326168 |
| Molecular Formula | C19H19Cl2NO3 |
| Molecular Weight | 380.27 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | 2-(3-acetylphenoxy)-N-[1-(2,4-dichlorophenyl)ethyl]propanamide |
| SMILES | CC(=O)c1cccc(OC(C)C(=O)NC(C)c2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C19H19Cl2NO3/c1-11(17-8-7-15(20)10-18(17)21)22-19(24)13(3)25-16-6-4-5-14(9-16)12(2)23/h4-11,13H,1-3H3,(H,22,24) |
| InChIKey | CFAKAKRRVYRUFX-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.27 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |