C26H33N3O5 — CID 55328554
N-methyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-4-oxo-4-(4-propoxyphenyl)butanamide (PubChem CID 55328554) has the molecular formula C26H33N3O5 and a molecular weight of 467.57 g/mol. Its IUPAC name is N-methyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-4-oxo-4-(4-propoxyphenyl)butanamide.
| Compound Name | N-methyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-4-oxo-4-(4-propoxyphenyl)butanamide |
|---|---|
| PubChem CID | 55328554 |
| Molecular Formula | C26H33N3O5 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | N-methyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-4-oxo-4-(4-propoxyphenyl)butanamide |
| SMILES | CCCOc1ccc(C(=O)CCC(=O)N(C)CC(=O)Nc2ccc(N3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C26H33N3O5/c1-3-16-34-23-10-4-20(5-11-23)24(30)12-13-26(32)28(2)19-25(31)27-21-6-8-22(9-7-21)29-14-17-33-18-15-29/h4-11H,3,12-19H2,1-2H3,(H,27,31) |
| InChIKey | DYTMESGCLNTHPL-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|