C25H30N4O5 — CID 55720026
4-(4-cyano-2-methoxyphenoxy)-N-methyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]butanamide (PubChem CID 55720026) has the molecular formula C25H30N4O5 and a molecular weight of 466.54 g/mol. Its IUPAC name is 4-(4-cyano-2-methoxyphenoxy)-N-methyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]butanamide.
| Compound Name | 4-(4-cyano-2-methoxyphenoxy)-N-methyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]butanamide |
|---|---|
| PubChem CID | 55720026 |
| Molecular Formula | C25H30N4O5 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | 4-(4-cyano-2-methoxyphenoxy)-N-methyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]butanamide |
| SMILES | COc1cc(C#N)ccc1OCCCC(=O)N(C)CC(=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C25H30N4O5/c1-28(25(31)4-3-13-34-22-10-5-19(17-26)16-23(22)32-2)18-24(30)27-20-6-8-21(9-7-20)29-11-14-33-15-12-29/h5-10,16H,3-4,11-15,18H2,1-2H3,(H,27,30) |
| InChIKey | QIRFEXKKOIICNL-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 104.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|