C22H32N2O3 — CID 55329551
N-[1-[2-(cyclohexen-1-yl)ethylamino]-3-methyl-1-oxobutan-2-yl]-4-ethoxybenzamide (PubChem CID 55329551) has the molecular formula C22H32N2O3 and a molecular weight of 372.51 g/mol. Its IUPAC name is N-[1-[2-(cyclohexen-1-yl)ethylamino]-3-methyl-1-oxobutan-2-yl]-4-ethoxybenzamide.
| Compound Name | N-[1-[2-(cyclohexen-1-yl)ethylamino]-3-methyl-1-oxobutan-2-yl]-4-ethoxybenzamide |
|---|---|
| PubChem CID | 55329551 |
| Molecular Formula | C22H32N2O3 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | N-[1-[2-(cyclohexen-1-yl)ethylamino]-3-methyl-1-oxobutan-2-yl]-4-ethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)NC(C(=O)NCCC2=CCCCC2)C(C)C)cc1 |
| InChI | InChI=1S/C22H32N2O3/c1-4-27-19-12-10-18(11-13-19)21(25)24-20(16(2)3)22(26)23-15-14-17-8-6-5-7-9-17/h8,10-13,16,20H,4-7,9,14-15H2,1-3H3,(H,23,26)(H,24,25) |
| InChIKey | IIWPGKMDPSUURE-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|