C24H30FN3O4S — CID 55331695
1-(benzenesulfonyl)-N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]piperidine-2-carboxamide (PubChem CID 55331695) has the molecular formula C24H30FN3O4S and a molecular weight of 475.59 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]piperidine-2-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 55331695 |
| Molecular Formula | C24H30FN3O4S |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | 1-(benzenesulfonyl)-N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]piperidine-2-carboxamide |
| SMILES | O=C(NCC(c1ccc(F)cc1)N1CCOCC1)C1CCCCN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H30FN3O4S/c25-20-11-9-19(10-12-20)23(27-14-16-32-17-15-27)18-26-24(29)22-8-4-5-13-28(22)33(30,31)21-6-2-1-3-7-21/h1-3,6-7,9-12,22-23H,4-5,8,13-18H2,(H,26,29) |
| InChIKey | AEGKVWIZRVIALT-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |