C25H32FN3O4S — CID 55331672
N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-3-(2-methylpiperidin-1-yl)sulfonylbenzamide (PubChem CID 55331672) has the molecular formula C25H32FN3O4S and a molecular weight of 489.61 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-3-(2-methylpiperidin-1-yl)sulfonylbenzamide.
| Compound Name | N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-3-(2-methylpiperidin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 55331672 |
| Molecular Formula | C25H32FN3O4S |
| Molecular Weight | 489.61 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-3-(2-methylpiperidin-1-yl)sulfonylbenzamide |
| SMILES | CC1CCCCN1S(=O)(=O)c1cccc(C(=O)NCC(c2ccc(F)cc2)N2CCOCC2)c1 |
| InChI | InChI=1S/C25H32FN3O4S/c1-19-5-2-3-12-29(19)34(31,32)23-7-4-6-21(17-23)25(30)27-18-24(28-13-15-33-16-14-28)20-8-10-22(26)11-9-20/h4,6-11,17,19,24H,2-3,5,12-16,18H2,1H3,(H,27,30) |
| InChIKey | FMXGZBGENOKCCM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.61 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |