C23H30N4O4S — CID 42930977
3-(2-methylpiperidin-1-yl)sulfonyl-N-[(6-morpholin-4-yl-3-pyridinyl)methyl]benzamide (PubChem CID 42930977) has the molecular formula C23H30N4O4S and a molecular weight of 458.58 g/mol. Its IUPAC name is 3-(2-methylpiperidin-1-yl)sulfonyl-N-[(6-morpholin-4-yl-3-pyridinyl)methyl]benzamide.
| Compound Name | 3-(2-methylpiperidin-1-yl)sulfonyl-N-[(6-morpholin-4-yl-3-pyridinyl)methyl]benzamide |
|---|---|
| PubChem CID | 42930977 |
| Molecular Formula | C23H30N4O4S |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 3-(2-methylpiperidin-1-yl)sulfonyl-N-[(6-morpholin-4-yl-3-pyridinyl)methyl]benzamide |
| SMILES | CC1CCCCN1S(=O)(=O)c1cccc(C(=O)NCc2ccc(N3CCOCC3)nc2)c1 |
| InChI | InChI=1S/C23H30N4O4S/c1-18-5-2-3-10-27(18)32(29,30)21-7-4-6-20(15-21)23(28)25-17-19-8-9-22(24-16-19)26-11-13-31-14-12-26/h4,6-9,15-16,18H,2-3,5,10-14,17H2,1H3,(H,25,28) |
| InChIKey | XOWWUMNLSOPVHF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |