C19H21FN2O4S — CID 110343552
N-[(4-fluorophenyl)methyl]-3-(3-methylmorpholin-4-yl)sulfonylbenzamide (PubChem CID 110343552) has the molecular formula C19H21FN2O4S and a molecular weight of 392.45 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-3-(3-methylmorpholin-4-yl)sulfonylbenzamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-3-(3-methylmorpholin-4-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 110343552 |
| Molecular Formula | C19H21FN2O4S |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-3-(3-methylmorpholin-4-yl)sulfonylbenzamide |
| SMILES | CC1COCCN1S(=O)(=O)c1cccc(C(=O)NCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C19H21FN2O4S/c1-14-13-26-10-9-22(14)27(24,25)18-4-2-3-16(11-18)19(23)21-12-15-5-7-17(20)8-6-15/h2-8,11,14H,9-10,12-13H2,1H3,(H,21,23) |
| InChIKey | BZOKWHFYRUDKLE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |