C24H26ClN3O4 — CID 55332893
N-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-N-cyclopropyl-4-(2-ethoxyphenoxy)butanamide (PubChem CID 55332893) has the molecular formula C24H26ClN3O4 and a molecular weight of 455.94 g/mol. Its IUPAC name is N-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-N-cyclopropyl-4-(2-ethoxyphenoxy)butanamide.
| Compound Name | N-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-N-cyclopropyl-4-(2-ethoxyphenoxy)butanamide |
|---|---|
| PubChem CID | 55332893 |
| Molecular Formula | C24H26ClN3O4 |
| Molecular Weight | 455.94 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | N-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-N-cyclopropyl-4-(2-ethoxyphenoxy)butanamide |
| SMILES | CCOc1ccccc1OCCCC(=O)N(Cc1nnc(-c2ccc(Cl)cc2)o1)C1CC1 |
| InChI | InChI=1S/C24H26ClN3O4/c1-2-30-20-6-3-4-7-21(20)31-15-5-8-23(29)28(19-13-14-19)16-22-26-27-24(32-22)17-9-11-18(25)12-10-17/h3-4,6-7,9-12,19H,2,5,8,13-16H2,1H3 |
| InChIKey | PVFLBQNCFORTRI-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 77.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.94 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|