C23H23Cl2N3O3 — CID 16557591
4-(4-chloro-2-methylphenoxy)-N-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-N-cyclopropylbutanamide (PubChem CID 16557591) has the molecular formula C23H23Cl2N3O3 and a molecular weight of 460.36 g/mol. Its IUPAC name is 4-(4-chloro-2-methylphenoxy)-N-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-N-cyclopropylbutanamide.
| Compound Name | 4-(4-chloro-2-methylphenoxy)-N-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-N-cyclopropylbutanamide |
|---|---|
| PubChem CID | 16557591 |
| Molecular Formula | C23H23Cl2N3O3 |
| Molecular Weight | 460.36 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | 4-(4-chloro-2-methylphenoxy)-N-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-N-cyclopropylbutanamide |
| SMILES | Cc1cc(Cl)ccc1OCCCC(=O)N(Cc1nnc(-c2ccccc2Cl)o1)C1CC1 |
| InChI | InChI=1S/C23H23Cl2N3O3/c1-15-13-16(24)8-11-20(15)30-12-4-7-22(29)28(17-9-10-17)14-21-26-27-23(31-21)18-5-2-3-6-19(18)25/h2-3,5-6,8,11,13,17H,4,7,9-10,12,14H2,1H3 |
| InChIKey | LCMASQNDOZEEOW-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.36 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|