C23H25Cl2N3O3 — CID 112794817
4-(4-chloro-3-methylphenoxy)-N-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-N-propan-2-ylbutanamide (PubChem CID 112794817) has the molecular formula C23H25Cl2N3O3 and a molecular weight of 462.38 g/mol. Its IUPAC name is 4-(4-chloro-3-methylphenoxy)-N-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-N-propan-2-ylbutanamide.
| Compound Name | 4-(4-chloro-3-methylphenoxy)-N-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-N-propan-2-ylbutanamide |
|---|---|
| PubChem CID | 112794817 |
| Molecular Formula | C23H25Cl2N3O3 |
| Molecular Weight | 462.38 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | 4-(4-chloro-3-methylphenoxy)-N-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-N-propan-2-ylbutanamide |
| SMILES | Cc1cc(OCCCC(=O)N(Cc2nnc(-c3ccccc3Cl)o2)C(C)C)ccc1Cl |
| InChI | InChI=1S/C23H25Cl2N3O3/c1-15(2)28(14-21-26-27-23(31-21)18-7-4-5-8-20(18)25)22(29)9-6-12-30-17-10-11-19(24)16(3)13-17/h4-5,7-8,10-11,13,15H,6,9,12,14H2,1-3H3 |
| InChIKey | PROZXGUTZZTXOE-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.38 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|