C19H18Cl2N4O2 — CID 86933441
N-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-2-(6-chloro-3-pyridinyl)-N-propan-2-ylacetamide (PubChem CID 86933441) has the molecular formula C19H18Cl2N4O2 and a molecular weight of 405.29 g/mol. Its IUPAC name is N-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-2-(6-chloro-3-pyridinyl)-N-propan-2-ylacetamide.
| Compound Name | N-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-2-(6-chloro-3-pyridinyl)-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 86933441 |
| Molecular Formula | C19H18Cl2N4O2 |
| Molecular Weight | 405.29 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | N-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-2-(6-chloro-3-pyridinyl)-N-propan-2-ylacetamide |
| SMILES | CC(C)N(Cc1nnc(-c2ccccc2Cl)o1)C(=O)Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C19H18Cl2N4O2/c1-12(2)25(18(26)9-13-7-8-16(21)22-10-13)11-17-23-24-19(27-17)14-5-3-4-6-15(14)20/h3-8,10,12H,9,11H2,1-2H3 |
| InChIKey | NGGUKBINZNNCSA-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 72.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.29 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|