C22H24ClN3O4 — CID 55758153
N-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-2-(2-phenoxyethoxy)-N-propan-2-ylacetamide (PubChem CID 55758153) has the molecular formula C22H24ClN3O4 and a molecular weight of 429.90 g/mol. Its IUPAC name is N-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-2-(2-phenoxyethoxy)-N-propan-2-ylacetamide.
| Compound Name | N-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-2-(2-phenoxyethoxy)-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 55758153 |
| Molecular Formula | C22H24ClN3O4 |
| Molecular Weight | 429.90 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | N-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-2-(2-phenoxyethoxy)-N-propan-2-ylacetamide |
| SMILES | CC(C)N(Cc1nnc(-c2ccccc2Cl)o1)C(=O)COCCOc1ccccc1 |
| InChI | InChI=1S/C22H24ClN3O4/c1-16(2)26(21(27)15-28-12-13-29-17-8-4-3-5-9-17)14-20-24-25-22(30-20)18-10-6-7-11-19(18)23/h3-11,16H,12-15H2,1-2H3 |
| InChIKey | BOCFAOSXFWHJMY-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 77.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.90 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|