C22H23ClFN3O3 — CID 78843426
N-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-4-(4-fluorophenoxy)-N-propan-2-ylbutanamide (PubChem CID 78843426) has the molecular formula C22H23ClFN3O3 and a molecular weight of 431.90 g/mol. Its IUPAC name is N-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-4-(4-fluorophenoxy)-N-propan-2-ylbutanamide.
| Compound Name | N-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-4-(4-fluorophenoxy)-N-propan-2-ylbutanamide |
|---|---|
| PubChem CID | 78843426 |
| Molecular Formula | C22H23ClFN3O3 |
| Molecular Weight | 431.90 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | N-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-4-(4-fluorophenoxy)-N-propan-2-ylbutanamide |
| SMILES | CC(C)N(Cc1nnc(-c2ccccc2Cl)o1)C(=O)CCCOc1ccc(F)cc1 |
| InChI | InChI=1S/C22H23ClFN3O3/c1-15(2)27(21(28)8-5-13-29-17-11-9-16(24)10-12-17)14-20-25-26-22(30-20)18-6-3-4-7-19(18)23/h3-4,6-7,9-12,15H,5,8,13-14H2,1-2H3 |
| InChIKey | PQFQDSFHLJJMBG-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.90 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|