C25H25N3O5 — CID 55333265
N'-[2-(2,5-dimethylphenoxy)acetyl]-2-(furan-2-carbonyl)-3,4-dihydro-1H-isoquinoline-3-carbohydrazide (PubChem CID 55333265) has the molecular formula C25H25N3O5 and a molecular weight of 447.49 g/mol. Its IUPAC name is N'-[2-(2,5-dimethylphenoxy)acetyl]-2-(furan-2-carbonyl)-3,4-dihydro-1H-isoquinoline-3-carbohydrazide.
| Compound Name | N'-[2-(2,5-dimethylphenoxy)acetyl]-2-(furan-2-carbonyl)-3,4-dihydro-1H-isoquinoline-3-carbohydrazide |
|---|---|
| PubChem CID | 55333265 |
| Molecular Formula | C25H25N3O5 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | N'-[2-(2,5-dimethylphenoxy)acetyl]-2-(furan-2-carbonyl)-3,4-dihydro-1H-isoquinoline-3-carbohydrazide |
| SMILES | Cc1ccc(C)c(OCC(=O)NNC(=O)C2Cc3ccccc3CN2C(=O)c2ccco2)c1 |
| InChI | InChI=1S/C25H25N3O5/c1-16-9-10-17(2)22(12-16)33-15-23(29)26-27-24(30)20-13-18-6-3-4-7-19(18)14-28(20)25(31)21-8-5-11-32-21/h3-12,20H,13-15H2,1-2H3,(H,26,29)(H,27,30) |
| InChIKey | NWZCMHMXLVKBHF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|