C25H21N5O4S — CID 55333330
N'-[2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide (PubChem CID 55333330) has the molecular formula C25H21N5O4S and a molecular weight of 487.54 g/mol. Its IUPAC name is N'-[2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide.
| Compound Name | N'-[2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide |
|---|---|
| PubChem CID | 55333330 |
| Molecular Formula | C25H21N5O4S |
| Molecular Weight | 487.54 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | N'-[2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide |
| SMILES | O=C(CSc1nnc(-c2ccccc2)n1-c1ccccc1)NNC(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C25H21N5O4S/c31-22(26-28-24(32)18-11-12-20-21(15-18)34-14-13-33-20)16-35-25-29-27-23(17-7-3-1-4-8-17)30(25)19-9-5-2-6-10-19/h1-12,15H,13-14,16H2,(H,26,31)(H,28,32) |
| InChIKey | CDWIAPAWWMYYIT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.54 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|