C21H21N5O4S — CID 55505561
N'-[2-[[4-(3,4-dimethylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide (PubChem CID 55505561) has the molecular formula C21H21N5O4S and a molecular weight of 439.50 g/mol. Its IUPAC name is N'-[2-[[4-(3,4-dimethylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide.
| Compound Name | N'-[2-[[4-(3,4-dimethylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide |
|---|---|
| PubChem CID | 55505561 |
| Molecular Formula | C21H21N5O4S |
| Molecular Weight | 439.50 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | N'-[2-[[4-(3,4-dimethylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide |
| SMILES | Cc1ccc(-n2cnnc2SCC(=O)NNC(=O)c2ccc3c(c2)OCCO3)cc1C |
| InChI | InChI=1S/C21H21N5O4S/c1-13-3-5-16(9-14(13)2)26-12-22-25-21(26)31-11-19(27)23-24-20(28)15-4-6-17-18(10-15)30-8-7-29-17/h3-6,9-10,12H,7-8,11H2,1-2H3,(H,23,27)(H,24,28) |
| InChIKey | YFDRQXKVHGRYFL-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.50 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|