C21H23N7OS2 — CID 55339139
N-(5-butyl-1,3,4-thiadiazol-2-yl)-2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]benzamide (PubChem CID 55339139) has the molecular formula C21H23N7OS2 and a molecular weight of 453.60 g/mol. Its IUPAC name is N-(5-butyl-1,3,4-thiadiazol-2-yl)-2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]benzamide.
| Compound Name | N-(5-butyl-1,3,4-thiadiazol-2-yl)-2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 55339139 |
| Molecular Formula | C21H23N7OS2 |
| Molecular Weight | 453.60 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | N-(5-butyl-1,3,4-thiadiazol-2-yl)-2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]benzamide |
| SMILES | CCCCc1nnc(NC(=O)c2ccccc2CSc2nc3nc(C)cc(C)n3n2)s1 |
| InChI | InChI=1S/C21H23N7OS2/c1-4-5-10-17-25-26-20(31-17)23-18(29)16-9-7-6-8-15(16)12-30-21-24-19-22-13(2)11-14(3)28(19)27-21/h6-9,11H,4-5,10,12H2,1-3H3,(H,23,26,29) |
| InChIKey | WRLIQIRXAJJFNL-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 97.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.60 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |